C28H25N3O7 — CID 11813281
8-O-methyl 6-O-propan-2-yl 3-amino-2-benzoyl-5-methyl-7-(2-nitrophenyl)indolizine-6,8-dicarboxylate (PubChem CID 11813281) has the molecular formula C28H25N3O7 and a molecular weight of 515.52 g/mol. Its IUPAC name is 8-O-methyl 6-O-propan-2-yl 3-amino-2-benzoyl-5-methyl-7-(2-nitrophenyl)indolizine-6,8-dicarboxylate.
| Compound Name | 8-O-methyl 6-O-propan-2-yl 3-amino-2-benzoyl-5-methyl-7-(2-nitrophenyl)indolizine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 11813281 |
| Molecular Formula | C28H25N3O7 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 8-O-methyl 6-O-propan-2-yl 3-amino-2-benzoyl-5-methyl-7-(2-nitrophenyl)indolizine-6,8-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2[N+](=O)[O-])c(C(=O)OC(C)C)c(C)n2c(N)c(C(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C28H25N3O7/c1-15(2)38-28(34)22-16(3)30-21(14-19(26(30)29)25(32)17-10-6-5-7-11-17)24(27(33)37-4)23(22)18-12-8-9-13-20(18)31(35)36/h5-15H,29H2,1-4H3 |
| InChIKey | IRTFBQPRMDFMHX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|