C23H21NO7 — CID 170341547
1-O,2-O-dimethyl 7-O-propan-2-yl 3-benzoylindolizine-1,2,7-tricarboxylate (PubChem CID 170341547) has the molecular formula C23H21NO7 and a molecular weight of 423.42 g/mol. Its IUPAC name is 1-O,2-O-dimethyl 7-O-propan-2-yl 3-benzoylindolizine-1,2,7-tricarboxylate.
| Compound Name | 1-O,2-O-dimethyl 7-O-propan-2-yl 3-benzoylindolizine-1,2,7-tricarboxylate |
|---|---|
| PubChem CID | 170341547 |
| Molecular Formula | C23H21NO7 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-O,2-O-dimethyl 7-O-propan-2-yl 3-benzoylindolizine-1,2,7-tricarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2cc(C(=O)OC(C)C)ccn2c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO7/c1-13(2)31-21(26)15-10-11-24-16(12-15)17(22(27)29-3)18(23(28)30-4)19(24)20(25)14-8-6-5-7-9-14/h5-13H,1-4H3 |
| InChIKey | ANDOFNJTKIGQHL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|