C20H21NO8 — CID 102592899
tetramethyl 1-(1-phenylethyl)pyrrole-2,3,4,5-tetracarboxylate (PubChem CID 102592899) has the molecular formula C20H21NO8 and a molecular weight of 403.39 g/mol. Its IUPAC name is tetramethyl 1-(1-phenylethyl)pyrrole-2,3,4,5-tetracarboxylate.
| Compound Name | tetramethyl 1-(1-phenylethyl)pyrrole-2,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 102592899 |
| Molecular Formula | C20H21NO8 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | tetramethyl 1-(1-phenylethyl)pyrrole-2,3,4,5-tetracarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(C(=O)OC)n(C(C)c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H21NO8/c1-11(12-9-7-6-8-10-12)21-15(19(24)28-4)13(17(22)26-2)14(18(23)27-3)16(21)20(25)29-5/h6-11H,1-5H3 |
| InChIKey | OGUITWWGTRBGAA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|