C18H16ClNO8 — CID 44632136
tetramethyl 1-(2-chlorophenyl)pyrrole-2,3,4,5-tetracarboxylate (PubChem CID 44632136) has the molecular formula C18H16ClNO8 and a molecular weight of 409.78 g/mol. Its IUPAC name is tetramethyl 1-(2-chlorophenyl)pyrrole-2,3,4,5-tetracarboxylate.
| Compound Name | tetramethyl 1-(2-chlorophenyl)pyrrole-2,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 44632136 |
| Molecular Formula | C18H16ClNO8 |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | tetramethyl 1-(2-chlorophenyl)pyrrole-2,3,4,5-tetracarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(C(=O)OC)n(-c2ccccc2Cl)c1C(=O)OC |
| InChI | InChI=1S/C18H16ClNO8/c1-25-15(21)11-12(16(22)26-2)14(18(24)28-4)20(13(11)17(23)27-3)10-8-6-5-7-9(10)19/h5-8H,1-4H3 |
| InChIKey | JNYOQAVEYSTQQB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|