C15H26Cl4O4 — CID 159853083
2,6-dichlorobenzoic acid;methyl 2,6-dichlorobenzoate;molecular hydrogen (PubChem CID 159853083) has the molecular formula C15H26Cl4O4 and a molecular weight of 412.18 g/mol. Its IUPAC name is 2,6-dichlorobenzoic acid;methyl 2,6-dichlorobenzoate;molecular hydrogen.
| Compound Name | 2,6-dichlorobenzoic acid;methyl 2,6-dichlorobenzoate;molecular hydrogen |
|---|---|
| PubChem CID | 159853083 |
| Molecular Formula | C15H26Cl4O4 |
| Molecular Weight | 412.18 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2,6-dichlorobenzoic acid;methyl 2,6-dichlorobenzoate;molecular hydrogen |
| SMILES | COC(=O)c1c(Cl)cccc1Cl.O=C(O)c1c(Cl)cccc1Cl.[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C8H6Cl2O2.C7H4Cl2O2.8H2/c1-12-8(11)7-5(9)3-2-4-6(7)10;8-4-2-1-3-5(9)6(4)7(10)11;;;;;;;;/h2-4H,1H3;1-3H,(H,10,11);8*1H |
| InChIKey | NQENJIZGFITWJL-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.18 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |