C15H10Cl4FNO4 — CID 162087567
2,6-dichloro-4-fluorobenzoic acid;methyl 4-amino-2,6-dichlorobenzoate (PubChem CID 162087567) has the molecular formula C15H10Cl4FNO4 and a molecular weight of 429.06 g/mol. Its IUPAC name is 2,6-dichloro-4-fluorobenzoic acid;methyl 4-amino-2,6-dichlorobenzoate.
| Compound Name | 2,6-dichloro-4-fluorobenzoic acid;methyl 4-amino-2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 162087567 |
| Molecular Formula | C15H10Cl4FNO4 |
| Molecular Weight | 429.06 g/mol |
| Exact Mass | 426.93 |
| IUPAC Name | 2,6-dichloro-4-fluorobenzoic acid;methyl 4-amino-2,6-dichlorobenzoate |
| SMILES | COC(=O)c1c(Cl)cc(N)cc1Cl.O=C(O)c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C8H7Cl2NO2.C7H3Cl2FO2/c1-13-8(12)7-5(9)2-4(11)3-6(7)10;8-4-1-3(10)2-5(9)6(4)7(11)12/h2-3H,11H2,1H3;1-2H,(H,11,12) |
| InChIKey | ZDEDEHQKPSOMLB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.06 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|