About methyl 6-amino-3-chloro-2,4-difluorobenzoate
methyl 6-amino-3-chloro-2,4-difluorobenzoate (PubChem CID 139378115) has the molecular formula C8H6ClF2NO2
and a molecular weight of 221.59 g/mol. Its IUPAC name is methyl 6-amino-3-chloro-2,4-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 6-amino-3-chloro-2,4-difluorobenzoate |
| PubChem CID | 139378115 |
| Molecular Formula | C8H6ClF2NO2 |
| Molecular Weight | 221.59 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | methyl 6-amino-3-chloro-2,4-difluorobenzoate |
| SMILES | COC(=O)c1c(N)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C8H6ClF2NO2/c1-14-8(13)5-4(12)2-3(10)6(9)7(5)11/h2H,12H2,1H3 |
| InChIKey | QAJKNJOUWJOHLS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-amino-3-chloro-2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-amino-3-chloro-2,4-difluorobenzoate?
The IUPAC name of methyl 6-amino-3-chloro-2,4-difluorobenzoate (CID 139378115) is methyl 6-amino-3-chloro-2,4-difluorobenzoate.
What is the SMILES notation for methyl 6-amino-3-chloro-2,4-difluorobenzoate?
The canonical SMILES for methyl 6-amino-3-chloro-2,4-difluorobenzoate is COC(=O)c1c(N)cc(F)c(Cl)c1F.
What is the InChIKey of methyl 6-amino-3-chloro-2,4-difluorobenzoate?
The InChIKey is QAJKNJOUWJOHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF2NO2/c1-14-8(13)5-4(12)2-3(10)6(9)7(5)11/h2H,12H2,1H3.
What are the key properties of methyl 6-amino-3-chloro-2,4-difluorobenzoate?
methyl 6-amino-3-chloro-2,4-difluorobenzoate has a molecular weight of 221.59 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-amino-3-chloro-2,4-difluorobenzoate is sourced from PubChem (CID 139378115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).