C8H6ClF2NO2 — CID 139378115
methyl 6-amino-3-chloro-2,4-difluorobenzoate (PubChem CID 139378115) has the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. Its IUPAC name is methyl 6-amino-3-chloro-2,4-difluorobenzoate.
| Compound Name | methyl 6-amino-3-chloro-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 139378115 |
| Molecular Formula | C8H6ClF2NO2 |
| Molecular Weight | 221.59 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | methyl 6-amino-3-chloro-2,4-difluorobenzoate |
| SMILES | COC(=O)c1c(N)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C8H6ClF2NO2/c1-14-8(13)5-4(12)2-3(10)6(9)7(5)11/h2H,12H2,1H3 |
| InChIKey | QAJKNJOUWJOHLS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|