C10H8F3NO4 — CID 12045796
dimethyl 4-amino-3,5,6-trifluorobenzene-1,2-dicarboxylate (PubChem CID 12045796) has the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. Its IUPAC name is dimethyl 4-amino-3,5,6-trifluorobenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-amino-3,5,6-trifluorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 12045796 |
| Molecular Formula | C10H8F3NO4 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | dimethyl 4-amino-3,5,6-trifluorobenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(F)c(N)c(F)c(F)c1C(=O)OC |
| InChI | InChI=1S/C10H8F3NO4/c1-17-9(15)3-4(10(16)18-2)6(12)8(14)7(13)5(3)11/h14H2,1-2H3 |
| InChIKey | ILWYTBOHUYVQJD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|