C10H9F3N2O4 — CID 45140711
dimethyl 3,4,6-trifluoro-5-hydrazinylbenzene-1,2-dicarboxylate (PubChem CID 45140711) has the molecular formula C10H9F3N2O4 and a molecular weight of 278.19 g/mol. Its IUPAC name is dimethyl 3,4,6-trifluoro-5-hydrazinylbenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3,4,6-trifluoro-5-hydrazinylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 45140711 |
| Molecular Formula | C10H9F3N2O4 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | dimethyl 3,4,6-trifluoro-5-hydrazinylbenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(F)c(F)c(NN)c(F)c1C(=O)OC |
| InChI | InChI=1S/C10H9F3N2O4/c1-18-9(16)3-4(10(17)19-2)6(12)8(15-14)7(13)5(3)11/h15H,14H2,1-2H3 |
| InChIKey | DHIYVNBGGNZUKI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|