C8H3Cl5O2 — CID 12827694
methyl 2,3,4,5,6-pentachlorobenzoate (PubChem CID 12827694) has the molecular formula C8H3Cl5O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl 2,3,4,5,6-pentachlorobenzoate.
| Compound Name | methyl 2,3,4,5,6-pentachlorobenzoate |
|---|---|
| PubChem CID | 12827694 |
| Molecular Formula | C8H3Cl5O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 305.86 |
| IUPAC Name | methyl 2,3,4,5,6-pentachlorobenzoate |
| SMILES | COC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H3Cl5O2/c1-15-8(14)2-3(9)5(11)7(13)6(12)4(2)10/h1H3 |
| InChIKey | GMJLEFPTCWSZNE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|