C9H5Cl4NO4 — CID 71506602
methyl 2,3,4,5-tetrachloro-6-(hydroxycarbamoyl)benzoate (PubChem CID 71506602) has the molecular formula C9H5Cl4NO4 and a molecular weight of 332.95 g/mol. Its IUPAC name is methyl 2,3,4,5-tetrachloro-6-(hydroxycarbamoyl)benzoate.
| Compound Name | methyl 2,3,4,5-tetrachloro-6-(hydroxycarbamoyl)benzoate |
|---|---|
| PubChem CID | 71506602 |
| Molecular Formula | C9H5Cl4NO4 |
| Molecular Weight | 332.95 g/mol |
| Exact Mass | 330.90 |
| IUPAC Name | methyl 2,3,4,5-tetrachloro-6-(hydroxycarbamoyl)benzoate |
| SMILES | COC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)NO |
| InChI | InChI=1S/C9H5Cl4NO4/c1-18-9(16)3-2(8(15)14-17)4(10)6(12)7(13)5(3)11/h17H,1H3,(H,14,15) |
| InChIKey | SXCXBXODDJFJHJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.95 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|