C12H11ClO8 — CID 53254317
trimethyl 4-chloro-5,6-dihydroxybenzene-1,2,3-tricarboxylate (PubChem CID 53254317) has the molecular formula C12H11ClO8 and a molecular weight of 318.67 g/mol. Its IUPAC name is trimethyl 4-chloro-5,6-dihydroxybenzene-1,2,3-tricarboxylate.
| Compound Name | trimethyl 4-chloro-5,6-dihydroxybenzene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 53254317 |
| Molecular Formula | C12H11ClO8 |
| Molecular Weight | 318.67 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | trimethyl 4-chloro-5,6-dihydroxybenzene-1,2,3-tricarboxylate |
| SMILES | COC(=O)c1c(O)c(O)c(Cl)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C12H11ClO8/c1-19-10(16)4-5(11(17)20-2)7(13)9(15)8(14)6(4)12(18)21-3/h14-15H,1-3H3 |
| InChIKey | OXJVSJUCSHOZBK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.67 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|