C10H9ClO5 — CID 6426724
methyl 5-chloro-3-formyl-2,4-dihydroxy-6-methylbenzoate (PubChem CID 6426724) has the molecular formula C10H9ClO5 and a molecular weight of 244.63 g/mol. Its IUPAC name is methyl 5-chloro-3-formyl-2,4-dihydroxy-6-methylbenzoate.
| Compound Name | methyl 5-chloro-3-formyl-2,4-dihydroxy-6-methylbenzoate |
|---|---|
| PubChem CID | 6426724 |
| Molecular Formula | C10H9ClO5 |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | methyl 5-chloro-3-formyl-2,4-dihydroxy-6-methylbenzoate |
| SMILES | COC(=O)c1c(C)c(Cl)c(O)c(C=O)c1O |
| InChI | InChI=1S/C10H9ClO5/c1-4-6(10(15)16-2)8(13)5(3-12)9(14)7(4)11/h3,13-14H,1-2H3 |
| InChIKey | FFAOPIYWYBVPCE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|