C10H10O6 — CID 71332014
methyl 3-formyl-2,6-dihydroxy-4-methoxybenzoate (PubChem CID 71332014) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is methyl 3-formyl-2,6-dihydroxy-4-methoxybenzoate.
| Compound Name | methyl 3-formyl-2,6-dihydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 71332014 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | methyl 3-formyl-2,6-dihydroxy-4-methoxybenzoate |
| SMILES | COC(=O)c1c(O)cc(OC)c(C=O)c1O |
| InChI | InChI=1S/C10H10O6/c1-15-7-3-6(12)8(10(14)16-2)9(13)5(7)4-11/h3-4,12-13H,1-2H3 |
| InChIKey | BPQORJAUPSRFGU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|