C9H10O5 — CID 71365717
2,4-dihydroxy-3,6-dimethoxybenzaldehyde (PubChem CID 71365717) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 2,4-dihydroxy-3,6-dimethoxybenzaldehyde.
| Compound Name | 2,4-dihydroxy-3,6-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 71365717 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2,4-dihydroxy-3,6-dimethoxybenzaldehyde |
| SMILES | COc1cc(O)c(OC)c(O)c1C=O |
| InChI | InChI=1S/C9H10O5/c1-13-7-3-6(11)9(14-2)8(12)5(7)4-10/h3-4,11-12H,1-2H3 |
| InChIKey | CGKQZJCKLYVFPW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|