C10H14O3 — CID 84658444
2,5-dimethoxy-3,4-dimethylphenol (PubChem CID 84658444) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,5-dimethoxy-3,4-dimethylphenol.
| Compound Name | 2,5-dimethoxy-3,4-dimethylphenol |
|---|---|
| PubChem CID | 84658444 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,5-dimethoxy-3,4-dimethylphenol |
| SMILES | COc1cc(O)c(OC)c(C)c1C |
| InChI | InChI=1S/C10H14O3/c1-6-7(2)10(13-4)8(11)5-9(6)12-3/h5,11H,1-4H3 |
| InChIKey | DVVIUISEDJEIIB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |