C11H13NO2 — CID 117282326
2,5-dimethoxy-3,4-dimethylbenzonitrile (PubChem CID 117282326) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,5-dimethoxy-3,4-dimethylbenzonitrile.
| Compound Name | 2,5-dimethoxy-3,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 117282326 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2,5-dimethoxy-3,4-dimethylbenzonitrile |
| SMILES | COc1cc(C#N)c(OC)c(C)c1C |
| InChI | InChI=1S/C11H13NO2/c1-7-8(2)11(14-4)9(6-12)5-10(7)13-3/h5H,1-4H3 |
| InChIKey | SZDNRCQIJXLLCZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |