C9H10N2O — CID 163496494
4-methoxy-5,6-dimethylpyridine-3-carbonitrile (PubChem CID 163496494) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-methoxy-5,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 4-methoxy-5,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163496494 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4-methoxy-5,6-dimethylpyridine-3-carbonitrile |
| SMILES | COc1c(C#N)cnc(C)c1C |
| InChI | InChI=1S/C9H10N2O/c1-6-7(2)11-5-8(4-10)9(6)12-3/h5H,1-3H3 |
| InChIKey | CRDXBFCMMUCFLI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |