C10H10N2 — CID 166951007
5-ethenyl-4,6-dimethylpyridine-3-carbonitrile (PubChem CID 166951007) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-ethenyl-4,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 5-ethenyl-4,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166951007 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 5-ethenyl-4,6-dimethylpyridine-3-carbonitrile |
| SMILES | C=Cc1c(C)ncc(C#N)c1C |
| InChI | InChI=1S/C10H10N2/c1-4-10-7(2)9(5-11)6-12-8(10)3/h4,6H,1H2,2-3H3 |
| InChIKey | LRZBFUOWOHFJKH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |