C12H15N5 — CID 166906247
6-[amino-[(2Z)-3-aminopenta-2,4-dien-2-yl]amino]-4-methylpyridine-3-carbonitrile (PubChem CID 166906247) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 6-[amino-[(2Z)-3-aminopenta-2,4-dien-2-yl]amino]-4-methylpyridine-3-carbonitrile.
| Compound Name | 6-[amino-[(2Z)-3-aminopenta-2,4-dien-2-yl]amino]-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166906247 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 6-[amino-[(2Z)-3-aminopenta-2,4-dien-2-yl]amino]-4-methylpyridine-3-carbonitrile |
| SMILES | C=C/C(N)=C(\C)N(N)c1cc(C)c(C#N)cn1 |
| InChI | InChI=1S/C12H15N5/c1-4-11(14)9(3)17(15)12-5-8(2)10(6-13)7-16-12/h4-5,7H,1,14-15H2,2-3H3/b11-9- |
| InChIKey | DANIYEHTQUEOEZ-LUAWRHEFSA-N |
| XLogP | 1.32 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|