About 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile
4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 82375874) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
Analyze 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
The IUPAC name of 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (CID 82375874) is 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
What is the SMILES notation for 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
The canonical SMILES for 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile is Cc1c(C#N)cnc2c1CCCC2.
What is the InChIKey of 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
The InChIKey is AMZKLYLLVFWLBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-8-9(6-12)7-13-11-5-3-2-4-10(8)11/h7H,2-5H2,1H3.
What are the key properties of 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile?
4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile has a molecular weight of 172.23 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile is sourced from PubChem (CID 82375874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).