4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid

C10H11NO2 — CID 23008697

IUPAC4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid
SMILESCc1c(C(=O)O)cnc2c1CCC2
InChIInChI=1S/C10H11NO2/c1-6-7-3-2-4-9(7)11-5-8(6)10(12)13/h5H,2-4H2,1H3,(H,12,13)
InChIKeyHTQDGJAMAGUMAZ-UHFFFAOYSA-N
MW177.20 g/mol
LogP1.58
Rot. Bonds1

About 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid

4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid (PubChem CID 23008697) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid
PubChem CID23008697
Molecular FormulaC10H11NO2
Molecular Weight177.20 g/mol
Exact Mass177.08
IUPAC Name4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid
SMILESCc1c(C(=O)O)cnc2c1CCC2
InChIInChI=1S/C10H11NO2/c1-6-7-3-2-4-9(7)11-5-8(6)10(12)13/h5H,2-4H2,1H3,(H,12,13)
InChIKeyHTQDGJAMAGUMAZ-UHFFFAOYSA-N
XLogP1.58
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.20
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid?
The IUPAC name of 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid (CID 23008697) is 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid.
What is the SMILES notation for 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid?
The canonical SMILES for 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid is Cc1c(C(=O)O)cnc2c1CCC2.
What is the InChIKey of 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid?
The InChIKey is HTQDGJAMAGUMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-6-7-3-2-4-9(7)11-5-8(6)10(12)13/h5H,2-4H2,1H3,(H,12,13).
What are the key properties of 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid?
4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid has a molecular weight of 177.20 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid is sourced from PubChem (CID 23008697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).