C11H19NO — CID 143004126
ethane;4-methoxy-2,3,5-trimethylpyridine (PubChem CID 143004126) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;4-methoxy-2,3,5-trimethylpyridine.
| Compound Name | ethane;4-methoxy-2,3,5-trimethylpyridine |
|---|---|
| PubChem CID | 143004126 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethane;4-methoxy-2,3,5-trimethylpyridine |
| SMILES | CC.COc1c(C)cnc(C)c1C |
| InChI | InChI=1S/C9H13NO.C2H6/c1-6-5-10-8(3)7(2)9(6)11-4;1-2/h5H,1-4H3;1-2H3 |
| InChIKey | HQABUHZDZKBWTD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |