About 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol (PubChem CID 10658970) has the molecular formula C11H17NO2S2
and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol.
Molecular Properties
| Compound Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol |
| PubChem CID | 10658970 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol |
| SMILES | COc1c(C)cnc(CSSCCO)c1C |
| InChI | InChI=1S/C11H17NO2S2/c1-8-6-12-10(7-16-15-5-4-13)9(2)11(8)14-3/h6,13H,4-5,7H2,1-3H3 |
| InChIKey | KMOHWXCPKXRPFI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol?
The IUPAC name of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol (CID 10658970) is 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol.
What is the SMILES notation for 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol?
The canonical SMILES for 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol is COc1c(C)cnc(CSSCCO)c1C.
What is the InChIKey of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol?
The InChIKey is KMOHWXCPKXRPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S2/c1-8-6-12-10(7-16-15-5-4-13)9(2)11(8)14-3/h6,13H,4-5,7H2,1-3H3.
What are the key properties of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol?
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol has a molecular weight of 259.40 g/mol, XLogP of 2.58, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyldisulfanyl]ethanol is sourced from PubChem (CID 10658970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).