C10H15N3OS — CID 65211555
(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate (PubChem CID 65211555) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate.
| Compound Name | (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate |
|---|---|
| PubChem CID | 65211555 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C10H15N3OS/c1-6-4-13-8(5-15-10(11)12)7(2)9(6)14-3/h4H,5H2,1-3H3,(H3,11,12) |
| InChIKey | YBSNNOSXMAXYDJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|