About (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate
(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate (PubChem CID 65211555) has the molecular formula C10H15N3OS
and a molecular weight of 225.32 g/mol. Its IUPAC name is (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate.
Molecular Properties
| Compound Name | (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate |
| PubChem CID | 65211555 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C10H15N3OS/c1-6-4-13-8(5-15-10(11)12)7(2)9(6)14-3/h4H,5H2,1-3H3,(H3,11,12) |
| InChIKey | YBSNNOSXMAXYDJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate?
The IUPAC name of (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate (CID 65211555) is (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate.
What is the SMILES notation for (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate?
The canonical SMILES for (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate is [H]/N=C(\N)SCc1ncc(C)c(OC)c1C.
What is the InChIKey of (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate?
The InChIKey is YBSNNOSXMAXYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS/c1-6-4-13-8(5-15-10(11)12)7(2)9(6)14-3/h4H,5H2,1-3H3,(H3,11,12).
What are the key properties of (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate?
(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate has a molecular weight of 225.32 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-3,5-dimethyl-2-pyridinyl)methyl carbamimidothioate is sourced from PubChem (CID 65211555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).