C11H17ClN2OS — CID 158475685
(3-methoxy-4,5-dimethylphenyl)methyl carbamimidothioate;hydrochloride (PubChem CID 158475685) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is (3-methoxy-4,5-dimethylphenyl)methyl carbamimidothioate;hydrochloride.
| Compound Name | (3-methoxy-4,5-dimethylphenyl)methyl carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 158475685 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (3-methoxy-4,5-dimethylphenyl)methyl carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCc1cc(C)c(C)c(OC)c1 |
| InChI | InChI=1S/C11H16N2OS.ClH/c1-7-4-9(6-15-11(12)13)5-10(14-3)8(7)2;/h4-5H,6H2,1-3H3,(H3,12,13);1H |
| InChIKey | YHQFJCRYXLJZCI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|