About (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride
(4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride (PubChem CID 44658057) has the molecular formula C13H21ClN2OS
and a molecular weight of 288.84 g/mol. Its IUPAC name is (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride |
| PubChem CID | 44658057 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCc1ccc(OCCCCC)cc1 |
| InChI | InChI=1S/C13H20N2OS.ClH/c1-2-3-4-9-16-12-7-5-11(6-8-12)10-17-13(14)15;/h5-8H,2-4,9-10H2,1H3,(H3,14,15);1H |
| InChIKey | PIATYZXVCQJQGY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride?
The IUPAC name of (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride (CID 44658057) is (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride.
What is the SMILES notation for (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride?
The canonical SMILES for (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride is Cl.[H]/N=C(\N)SCc1ccc(OCCCCC)cc1.
What is the InChIKey of (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride?
The InChIKey is PIATYZXVCQJQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2OS.ClH/c1-2-3-4-9-16-12-7-5-11(6-8-12)10-17-13(14)15;/h5-8H,2-4,9-10H2,1H3,(H3,14,15);1H.
What are the key properties of (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride?
(4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride has a molecular weight of 288.84 g/mol, XLogP of 3.80, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentoxyphenyl)methyl carbamimidothioate;hydrochloride is sourced from PubChem (CID 44658057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).