C22H30N4O2 — CID 67069769
3-[4-[4-[4-(3-amino-3-iminopropyl)phenoxy]butoxy]phenyl]propanimidamide (PubChem CID 67069769) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 3-[4-[4-[4-(3-amino-3-iminopropyl)phenoxy]butoxy]phenyl]propanimidamide.
| Compound Name | 3-[4-[4-[4-(3-amino-3-iminopropyl)phenoxy]butoxy]phenyl]propanimidamide |
|---|---|
| PubChem CID | 67069769 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 3-[4-[4-[4-(3-amino-3-iminopropyl)phenoxy]butoxy]phenyl]propanimidamide |
| SMILES | [H]/N=C(\N)CCc1ccc(OCCCCOc2ccc(CC/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C22H30N4O2/c23-21(24)13-7-17-3-9-19(10-4-17)27-15-1-2-16-28-20-11-5-18(6-12-20)8-14-22(25)26/h3-6,9-12H,1-2,7-8,13-16H2,(H3,23,24)(H3,25,26) |
| InChIKey | WTERQJSRCHJTBV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|