C23H34N4O2 — CID 158584747
4-[8-(4-carbamimidoylphenoxy)octoxy]benzenecarboximidamide;methane (PubChem CID 158584747) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 4-[8-(4-carbamimidoylphenoxy)octoxy]benzenecarboximidamide;methane.
| Compound Name | 4-[8-(4-carbamimidoylphenoxy)octoxy]benzenecarboximidamide;methane |
|---|---|
| PubChem CID | 158584747 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 4-[8-(4-carbamimidoylphenoxy)octoxy]benzenecarboximidamide;methane |
| SMILES | C.[H]/N=C(\N)c1ccc(OCCCCCCCCOc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C22H30N4O2.CH4/c23-21(24)17-7-11-19(12-8-17)27-15-5-3-1-2-4-6-16-28-20-13-9-18(10-14-20)22(25)26;/h7-14H,1-6,15-16H2,(H3,23,24)(H3,25,26);1H4 |
| InChIKey | HTRNSPSPABCBLT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|