C27H33N7O3 — CID 139715205
4-[2-[bis[2-(4-carbamimidoylphenoxy)ethyl]amino]ethoxy]benzenecarboximidamide (PubChem CID 139715205) has the molecular formula C27H33N7O3 and a molecular weight of 503.61 g/mol. Its IUPAC name is 4-[2-[bis[2-(4-carbamimidoylphenoxy)ethyl]amino]ethoxy]benzenecarboximidamide.
| Compound Name | 4-[2-[bis[2-(4-carbamimidoylphenoxy)ethyl]amino]ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 139715205 |
| Molecular Formula | C27H33N7O3 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 4-[2-[bis[2-(4-carbamimidoylphenoxy)ethyl]amino]ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCN(CCOc2ccc(/C(N)=N/[H])cc2)CCOc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C27H33N7O3/c28-25(29)19-1-7-22(8-2-19)35-16-13-34(14-17-36-23-9-3-20(4-10-23)26(30)31)15-18-37-24-11-5-21(6-12-24)27(32)33/h1-12H,13-18H2,(H3,28,29)(H3,30,31)(H3,32,33) |
| InChIKey | IBEQWIHDWCTKGH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 180.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|