C27H33N5O2 — CID 127042273
4-[3-[benzyl-[3-(4-carbamimidoylphenoxy)propyl]amino]propoxy]benzenecarboximidamide (PubChem CID 127042273) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-[3-[benzyl-[3-(4-carbamimidoylphenoxy)propyl]amino]propoxy]benzenecarboximidamide.
| Compound Name | 4-[3-[benzyl-[3-(4-carbamimidoylphenoxy)propyl]amino]propoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 127042273 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-[3-[benzyl-[3-(4-carbamimidoylphenoxy)propyl]amino]propoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCN(CCCOc2ccc(/C(N)=N/[H])cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H33N5O2/c28-26(29)22-8-12-24(13-9-22)33-18-4-16-32(20-21-6-2-1-3-7-21)17-5-19-34-25-14-10-23(11-15-25)27(30)31/h1-3,6-15H,4-5,16-20H2,(H3,28,29)(H3,30,31) |
| InChIKey | RQABZEFOUJNNGS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|