C45H61N5O2 — CID 142064114
4-[[3-[[6-[[3-[[4-(1-aminoethenyl)phenoxy]methyl]phenyl]methyl-butylamino]hexyl-butylamino]methyl]phenyl]methoxy]benzenecarboximidamide (PubChem CID 142064114) has the molecular formula C45H61N5O2 and a molecular weight of 704.02 g/mol. Its IUPAC name is 4-[[3-[[6-[[3-[[4-(1-aminoethenyl)phenoxy]methyl]phenyl]methyl-butylamino]hexyl-butylamino]methyl]phenyl]methoxy]benzenecarboximidamide.
| Compound Name | 4-[[3-[[6-[[3-[[4-(1-aminoethenyl)phenoxy]methyl]phenyl]methyl-butylamino]hexyl-butylamino]methyl]phenyl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 142064114 |
| Molecular Formula | C45H61N5O2 |
| Molecular Weight | 704.02 g/mol |
| Exact Mass | 703.48 |
| IUPAC Name | 4-[[3-[[6-[[3-[[4-(1-aminoethenyl)phenoxy]methyl]phenyl]methyl-butylamino]hexyl-butylamino]methyl]phenyl]methoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCc2cccc(CN(CCCC)CCCCCCN(CCCC)Cc3cccc(COc4ccc(C(=C)N)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C45H61N5O2/c1-4-6-26-49(32-37-14-12-16-39(30-37)34-51-43-22-18-41(19-23-43)36(3)46)28-10-8-9-11-29-50(27-7-5-2)33-38-15-13-17-40(31-38)35-52-44-24-20-42(21-25-44)45(47)48/h12-25,30-31H,3-11,26-29,32-35,46H2,1-2H3,(H3,47,48) |
| InChIKey | MSIRPIYZXJNBLA-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.02 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|