C27H34N4O2 — CID 160987111
4-[[3-butyl-5-[(4-carbamimidoylphenyl)methoxy]phenoxy]methyl]benzenecarboximidamide;methane (PubChem CID 160987111) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 4-[[3-butyl-5-[(4-carbamimidoylphenyl)methoxy]phenoxy]methyl]benzenecarboximidamide;methane.
| Compound Name | 4-[[3-butyl-5-[(4-carbamimidoylphenyl)methoxy]phenoxy]methyl]benzenecarboximidamide;methane |
|---|---|
| PubChem CID | 160987111 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 4-[[3-butyl-5-[(4-carbamimidoylphenyl)methoxy]phenoxy]methyl]benzenecarboximidamide;methane |
| SMILES | C.[H]/N=C(\N)c1ccc(COc2cc(CCCC)cc(OCc3ccc(/C(N)=N/[H])cc3)c2)cc1 |
| InChI | InChI=1S/C26H30N4O2.CH4/c1-2-3-4-20-13-23(31-16-18-5-9-21(10-6-18)25(27)28)15-24(14-20)32-17-19-7-11-22(12-8-19)26(29)30;/h5-15H,2-4,16-17H2,1H3,(H3,27,28)(H3,29,30);1H4 |
| InChIKey | TUCUTRQLPSUMLA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|