C16H20ClN3O — CID 82240770
4-[[4-(dimethylamino)phenyl]methoxy]benzenecarboximidamide;hydrochloride (PubChem CID 82240770) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]methoxy]benzenecarboximidamide;hydrochloride.
| Compound Name | 4-[[4-(dimethylamino)phenyl]methoxy]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 82240770 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]methoxy]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(OCc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H19N3O.ClH/c1-19(2)14-7-3-12(4-8-14)11-20-15-9-5-13(6-10-15)16(17)18;/h3-10H,11H2,1-2H3,(H3,17,18);1H |
| InChIKey | BGQYQIZVDJBCIG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|