C23H24N6O2 — CID 139902633
3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenecarboximidamide (PubChem CID 139902633) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenecarboximidamide.
| Compound Name | 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 139902633 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCc2cc(COc3ccc(/C(N)=N/[H])cc3)cc(/C(N)=N/[H])c2)cc1 |
| InChI | InChI=1S/C23H24N6O2/c24-21(25)16-1-5-19(6-2-16)30-12-14-9-15(11-18(10-14)23(28)29)13-31-20-7-3-17(4-8-20)22(26)27/h1-11H,12-13H2,(H3,24,25)(H3,26,27)(H3,28,29) |
| InChIKey | WXUBNYHCJWGXKA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 168.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|