C26H28N4O4 — CID 162165833
propan-2-yl 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoate (PubChem CID 162165833) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is propan-2-yl 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoate.
| Compound Name | propan-2-yl 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 162165833 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | propan-2-yl 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(OCc2cc(COc3ccc(/C(N)=N/[H])cc3)cc(C(=O)OC(C)C)c2)cc1 |
| InChI | InChI=1S/C26H28N4O4/c1-16(2)34-26(31)21-12-17(14-32-22-7-3-19(4-8-22)24(27)28)11-18(13-21)15-33-23-9-5-20(6-10-23)25(29)30/h3-13,16H,14-15H2,1-2H3,(H3,27,28)(H3,29,30) |
| InChIKey | GTATUWULZJKKKW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|