C23H22N4O4 — CID 161142921
3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoic acid (PubChem CID 161142921) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoic acid.
| Compound Name | 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 161142921 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCc2cc(COc3ccc(/C(N)=N/[H])cc3)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C23H22N4O4/c24-21(25)16-1-5-19(6-2-16)30-12-14-9-15(11-18(10-14)23(28)29)13-31-20-7-3-17(4-8-20)22(26)27/h1-11H,12-13H2,(H3,24,25)(H3,26,27)(H,28,29) |
| InChIKey | YBPFWYUEMOGHHT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|