C22H22N4O5S — CID 157409960
3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenesulfonic acid (PubChem CID 157409960) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenesulfonic acid.
| Compound Name | 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 157409960 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 3,5-bis[(4-carbamimidoylphenoxy)methyl]benzenesulfonic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCc2cc(COc3ccc(/C(N)=N/[H])cc3)cc(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H22N4O5S/c23-21(24)16-1-5-18(6-2-16)30-12-14-9-15(11-20(10-14)32(27,28)29)13-31-19-7-3-17(4-8-19)22(25)26/h1-11H,12-13H2,(H3,23,24)(H3,25,26)(H,27,28,29) |
| InChIKey | UPJVWPKXSOOJNF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 172.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|