C25H28N2O3 — CID 19794887
4-[5-(2-phenylmethoxyphenoxy)pentoxy]benzenecarboximidamide (PubChem CID 19794887) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[5-(2-phenylmethoxyphenoxy)pentoxy]benzenecarboximidamide.
| Compound Name | 4-[5-(2-phenylmethoxyphenoxy)pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 19794887 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 4-[5-(2-phenylmethoxyphenoxy)pentoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCCOc2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c26-25(27)21-13-15-22(16-14-21)28-17-7-2-8-18-29-23-11-5-6-12-24(23)30-19-20-9-3-1-4-10-20/h1,3-6,9-16H,2,7-8,17-19H2,(H3,26,27) |
| InChIKey | APUUCXCYXYBPTE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|