C19H25N4O2+ — CID 24848374
[amino-[4-[5-(4-carbamimidoylphenoxy)pentoxy]phenyl]methylidene]azanium (PubChem CID 24848374) has the molecular formula C19H25N4O2+ and a molecular weight of 341.44 g/mol. Its IUPAC name is [amino-[4-[5-(4-carbamimidoylphenoxy)pentoxy]phenyl]methylidene]azanium.
| Compound Name | [amino-[4-[5-(4-carbamimidoylphenoxy)pentoxy]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 24848374 |
| Molecular Formula | C19H25N4O2+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [amino-[4-[5-(4-carbamimidoylphenoxy)pentoxy]phenyl]methylidene]azanium |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCCOc2ccc(C(N)=[NH2+])cc2)cc1 |
| InChI | InChI=1S/C19H24N4O2/c20-18(21)14-4-8-16(9-5-14)24-12-2-1-3-13-25-17-10-6-15(7-11-17)19(22)23/h4-11H,1-3,12-13H2,(H3,20,21)(H3,22,23)/p+1 |
| InChIKey | XDRYMKDFEDOLFX-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 119.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|