C22H32N2O2 — CID 158279595
molecular hydrogen;4-[6-(4-prop-1-en-2-ylphenoxy)hexoxy]benzenecarboximidamide (PubChem CID 158279595) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is molecular hydrogen;4-[6-(4-prop-1-en-2-ylphenoxy)hexoxy]benzenecarboximidamide.
| Compound Name | molecular hydrogen;4-[6-(4-prop-1-en-2-ylphenoxy)hexoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 158279595 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | molecular hydrogen;4-[6-(4-prop-1-en-2-ylphenoxy)hexoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCCCOc2ccc(C(=C)C)cc2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C22H28N2O2.2H2/c1-17(2)18-7-11-20(12-8-18)25-15-5-3-4-6-16-26-21-13-9-19(10-14-21)22(23)24;;/h7-14H,1,3-6,15-16H2,2H3,(H3,23,24);2*1H |
| InChIKey | GKAYHSXCORJOJP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|