C13H22N2O — CID 62601079
1-(4-methoxy-3,5-dimethyl-2-pyridinyl)pentan-2-amine (PubChem CID 62601079) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)pentan-2-amine.
| Compound Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)pentan-2-amine |
|---|---|
| PubChem CID | 62601079 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)pentan-2-amine |
| SMILES | CCCC(N)Cc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C13H22N2O/c1-5-6-11(14)7-12-10(3)13(16-4)9(2)8-15-12/h8,11H,5-7,14H2,1-4H3 |
| InChIKey | JWWYQZOLQDUISO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |