C15H26N2O3 — CID 102927982
1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-4-(2-methoxyethoxy)butan-2-amine (PubChem CID 102927982) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-4-(2-methoxyethoxy)butan-2-amine.
| Compound Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-4-(2-methoxyethoxy)butan-2-amine |
|---|---|
| PubChem CID | 102927982 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-4-(2-methoxyethoxy)butan-2-amine |
| SMILES | COCCOCCC(N)Cc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C15H26N2O3/c1-11-10-17-14(12(2)15(11)19-4)9-13(16)5-6-20-8-7-18-3/h10,13H,5-9,16H2,1-4H3 |
| InChIKey | XIEWCAMLZFRXRS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|