C14H10N2O2 — CID 15323116
5,8-dimethoxynaphthalene-2,3-dicarbonitrile (PubChem CID 15323116) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 5,8-dimethoxynaphthalene-2,3-dicarbonitrile.
| Compound Name | 5,8-dimethoxynaphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 15323116 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5,8-dimethoxynaphthalene-2,3-dicarbonitrile |
| SMILES | COc1ccc(OC)c2cc(C#N)c(C#N)cc12 |
| InChI | InChI=1S/C14H10N2O2/c1-17-13-3-4-14(18-2)12-6-10(8-16)9(7-15)5-11(12)13/h3-6H,1-2H3 |
| InChIKey | MOQXLOAXYGLWHU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |