C11H13NO4 — CID 71368082
2,3,4,5-tetramethoxybenzonitrile (PubChem CID 71368082) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2,3,4,5-tetramethoxybenzonitrile.
| Compound Name | 2,3,4,5-tetramethoxybenzonitrile |
|---|---|
| PubChem CID | 71368082 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2,3,4,5-tetramethoxybenzonitrile |
| SMILES | COc1cc(C#N)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C11H13NO4/c1-13-8-5-7(6-12)9(14-2)11(16-4)10(8)15-3/h5H,1-4H3 |
| InChIKey | YKIDBYBROXWWKZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |