C11H13NO3 — CID 117295608
5-(1-hydroxyethyl)-2,3-dimethoxybenzonitrile (PubChem CID 117295608) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-(1-hydroxyethyl)-2,3-dimethoxybenzonitrile.
| Compound Name | 5-(1-hydroxyethyl)-2,3-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 117295608 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 5-(1-hydroxyethyl)-2,3-dimethoxybenzonitrile |
| SMILES | COc1cc(C(C)O)cc(C#N)c1OC |
| InChI | InChI=1S/C11H13NO3/c1-7(13)8-4-9(6-12)11(15-3)10(5-8)14-2/h4-5,7,13H,1-3H3 |
| InChIKey | GJBBCFUZZGSVFD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |