C12H20ClNO4 — CID 75069436
2-amino-1-(3,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride (PubChem CID 75069436) has the molecular formula C12H20ClNO4 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-amino-1-(3,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride.
| Compound Name | 2-amino-1-(3,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 75069436 |
| Molecular Formula | C12H20ClNO4 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-amino-1-(3,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride |
| SMILES | COc1cc(C(O)C(C)N)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C12H19NO4.ClH/c1-7(13)11(14)8-5-9(15-2)12(17-4)10(6-8)16-3;/h5-7,11,14H,13H2,1-4H3;1H |
| InChIKey | GIJLIZWLJMONRO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |