C13H22N2O3 — CID 116933323
1-(3,4,5-trimethoxyphenyl)butane-1,3-diamine (PubChem CID 116933323) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)butane-1,3-diamine.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 116933323 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)butane-1,3-diamine |
| SMILES | COc1cc(C(N)CC(C)N)cc(OC)c1OC |
| InChI | InChI=1S/C13H22N2O3/c1-8(14)5-10(15)9-6-11(16-2)13(18-4)12(7-9)17-3/h6-8,10H,5,14-15H2,1-4H3 |
| InChIKey | VTUIXQCPPKOGRB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |