C15H25NO3 — CID 171219160
(1S)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentan-1-amine (PubChem CID 171219160) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (1S)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentan-1-amine.
| Compound Name | (1S)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentan-1-amine |
|---|---|
| PubChem CID | 171219160 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (1S)-4-methyl-1-(3,4,5-trimethoxyphenyl)pentan-1-amine |
| SMILES | COc1cc([C@@H](N)CCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H25NO3/c1-10(2)6-7-12(16)11-8-13(17-3)15(19-5)14(9-11)18-4/h8-10,12H,6-7,16H2,1-5H3/t12-/m0/s1 |
| InChIKey | FDKHFNHXJGXGHR-LBPRGKRZSA-N |
| XLogP | 3.15 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |