C12H16N2O3 — CID 95452478
(3S)-3-amino-3-(3,4,5-trimethoxyphenyl)propanenitrile (PubChem CID 95452478) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3S)-3-amino-3-(3,4,5-trimethoxyphenyl)propanenitrile.
| Compound Name | (3S)-3-amino-3-(3,4,5-trimethoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 95452478 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3S)-3-amino-3-(3,4,5-trimethoxyphenyl)propanenitrile |
| SMILES | COc1cc([C@@H](N)CC#N)cc(OC)c1OC |
| InChI | InChI=1S/C12H16N2O3/c1-15-10-6-8(9(14)4-5-13)7-11(16-2)12(10)17-3/h6-7,9H,4,14H2,1-3H3/t9-/m0/s1 |
| InChIKey | DCTUGOXPMAXSIT-VIFPVBQESA-N |
| XLogP | 1.63 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |